C15H13Cl2N5O3 — CID 164791301
1-[10,11-dichloro-13-(5-methyl-1,3,4-oxadiazol-2-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-4-yl]-2-hydroxyethanone (PubChem CID 164791301) has the molecular formula C15H13Cl2N5O3 and a molecular weight of 382.21 g/mol. Its IUPAC name is 1-[10,11-dichloro-13-(5-methyl-1,3,4-oxadiazol-2-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-4-yl]-2-hydroxyethanone.
| Compound Name | 1-[10,11-dichloro-13-(5-methyl-1,3,4-oxadiazol-2-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-4-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 164791301 |
| Molecular Formula | C15H13Cl2N5O3 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 1-[10,11-dichloro-13-(5-methyl-1,3,4-oxadiazol-2-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-4-yl]-2-hydroxyethanone |
| SMILES | Cc1nnc(-c2nc(Cl)c(Cl)c3[nH]c4c(c23)CN(C(=O)CO)CC4)o1 |
| InChI | InChI=1S/C15H13Cl2N5O3/c1-6-20-21-15(25-6)13-10-7-4-22(9(24)5-23)3-2-8(7)18-12(10)11(16)14(17)19-13/h18,23H,2-5H2,1H3 |
| InChIKey | VZKBUOZNDKFCLR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|