C13H11BrClFN2O2 — CID 147848348
1-(8-bromo-7-chloro-6-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-hydroxyethanone (PubChem CID 147848348) has the molecular formula C13H11BrClFN2O2 and a molecular weight of 361.60 g/mol. Its IUPAC name is 1-(8-bromo-7-chloro-6-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-hydroxyethanone.
| Compound Name | 1-(8-bromo-7-chloro-6-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-hydroxyethanone |
|---|---|
| PubChem CID | 147848348 |
| Molecular Formula | C13H11BrClFN2O2 |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 1-(8-bromo-7-chloro-6-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-hydroxyethanone |
| SMILES | O=C(CO)N1CCc2[nH]c3c(F)c(Cl)c(Br)cc3c2C1 |
| InChI | InChI=1S/C13H11BrClFN2O2/c14-8-3-6-7-4-18(10(20)5-19)2-1-9(7)17-13(6)12(16)11(8)15/h3,17,19H,1-2,4-5H2 |
| InChIKey | HUIJWODRXCSYRG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|