C26H36Cl2N4O2 — CID 172580240
1-[6,7-dichloro-9-(2-decyl-1,5-dihydropyrazol-5-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone (PubChem CID 172580240) has the molecular formula C26H36Cl2N4O2 and a molecular weight of 507.51 g/mol. Its IUPAC name is 1-[6,7-dichloro-9-(2-decyl-1,5-dihydropyrazol-5-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone.
| Compound Name | 1-[6,7-dichloro-9-(2-decyl-1,5-dihydropyrazol-5-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 172580240 |
| Molecular Formula | C26H36Cl2N4O2 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 1-[6,7-dichloro-9-(2-decyl-1,5-dihydropyrazol-5-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone |
| SMILES | CCCCCCCCCCN1C=CC(c2cc(Cl)c(Cl)c3[nH]c4c(c23)CN(C(=O)CO)CC4)N1 |
| InChI | InChI=1S/C26H36Cl2N4O2/c1-2-3-4-5-6-7-8-9-12-32-14-11-22(30-32)18-15-20(27)25(28)26-24(18)19-16-31(23(34)17-33)13-10-21(19)29-26/h11,14-15,22,29-30,33H,2-10,12-13,16-17H2,1H3 |
| InChIKey | FXKOLPSRGDIXOE-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 71.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|