C29H48Cl2N6O3 — CID 172579954
N-[2-[[(Z)-3-amino-3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-9-yl]prop-1-enyl]amino]ethyl]formamide;ethane;octan-1-amine (PubChem CID 172579954) has the molecular formula C29H48Cl2N6O3 and a molecular weight of 599.65 g/mol. Its IUPAC name is N-[2-[[(Z)-3-amino-3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-9-yl]prop-1-enyl]amino]ethyl]formamide;ethane;octan-1-amine.
| Compound Name | N-[2-[[(Z)-3-amino-3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-9-yl]prop-1-enyl]amino]ethyl]formamide;ethane;octan-1-amine |
|---|---|
| PubChem CID | 172579954 |
| Molecular Formula | C29H48Cl2N6O3 |
| Molecular Weight | 599.65 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | N-[2-[[(Z)-3-amino-3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-9-yl]prop-1-enyl]amino]ethyl]formamide;ethane;octan-1-amine |
| SMILES | CC.CCCCCCCCN.NC(/C=C\NCCNC=O)c1cc(Cl)c(Cl)c2[nH]c3c(c12)CN(C(=O)CO)CC3 |
| InChI | InChI=1S/C19H23Cl2N5O3.C8H19N.C2H6/c20-13-7-11(14(22)1-3-23-4-5-24-10-28)17-12-8-26(16(29)9-27)6-2-15(12)25-19(17)18(13)21;1-2-3-4-5-6-7-8-9;1-2/h1,3,7,10,14,23,25,27H,2,4-6,8-9,22H2,(H,24,28);2-9H2,1H3;1-2H3/b3-1-;; |
| InChIKey | TWOQQJPHCFCXDZ-KUGGNXEISA-N |
| XLogP | 4.53 |
| TPSA | 149.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.65 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|