C28H35Cl2N5O6 — CID 177055397
[2-[9-[6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-3-pyridinyl]-6,7-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-oxoethyl] acetate (PubChem CID 177055397) has the molecular formula C28H35Cl2N5O6 and a molecular weight of 608.52 g/mol. Its IUPAC name is [2-[9-[6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-3-pyridinyl]-6,7-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[9-[6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-3-pyridinyl]-6,7-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 177055397 |
| Molecular Formula | C28H35Cl2N5O6 |
| Molecular Weight | 608.52 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | [2-[9-[6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethylamino]-3-pyridinyl]-6,7-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)N1CCc2[nH]c3c(Cl)c(Cl)cc(-c4ccc(NCCOCCOCCOCCN)nc4)c3c2C1 |
| InChI | InChI=1S/C28H35Cl2N5O6/c1-18(36)41-17-25(37)35-7-4-23-21(16-35)26-20(14-22(29)27(30)28(26)34-23)19-2-3-24(33-15-19)32-6-9-39-11-13-40-12-10-38-8-5-31/h2-3,14-15,34H,4-13,16-17,31H2,1H3,(H,32,33) |
| InChIKey | YHPOQIXEUAWTPZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 141.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|