C18H18Cl2N4O2 — CID 155117474
1-[6,7-dichloro-9-(1,3-dimethylpyrazol-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone (PubChem CID 155117474) has the molecular formula C18H18Cl2N4O2 and a molecular weight of 393.27 g/mol. Its IUPAC name is 1-[6,7-dichloro-9-(1,3-dimethylpyrazol-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone.
| Compound Name | 1-[6,7-dichloro-9-(1,3-dimethylpyrazol-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 155117474 |
| Molecular Formula | C18H18Cl2N4O2 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 1-[6,7-dichloro-9-(1,3-dimethylpyrazol-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone |
| SMILES | Cc1nn(C)cc1-c1cc(Cl)c(Cl)c2[nH]c3c(c12)CN(C(=O)CO)CC3 |
| InChI | InChI=1S/C18H18Cl2N4O2/c1-9-11(6-23(2)22-9)10-5-13(19)17(20)18-16(10)12-7-24(15(26)8-25)4-3-14(12)21-18/h5-6,21,25H,3-4,7-8H2,1-2H3 |
| InChIKey | JQZUCCJAJXDNDS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |