C22H19Cl2F2N3O2 — CID 177382976
1-[7,8-dichloro-5-(2,6-difluoro-3-pyridinyl)spiro[1,2,4,9-tetrahydrocarbazole-3,3'-pyrrolidine]-1'-yl]-2-hydroxyethanone (PubChem CID 177382976) has the molecular formula C22H19Cl2F2N3O2 and a molecular weight of 466.32 g/mol. Its IUPAC name is 1-[7,8-dichloro-5-(2,6-difluoro-3-pyridinyl)spiro[1,2,4,9-tetrahydrocarbazole-3,3'-pyrrolidine]-1'-yl]-2-hydroxyethanone.
| Compound Name | 1-[7,8-dichloro-5-(2,6-difluoro-3-pyridinyl)spiro[1,2,4,9-tetrahydrocarbazole-3,3'-pyrrolidine]-1'-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 177382976 |
| Molecular Formula | C22H19Cl2F2N3O2 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 1-[7,8-dichloro-5-(2,6-difluoro-3-pyridinyl)spiro[1,2,4,9-tetrahydrocarbazole-3,3'-pyrrolidine]-1'-yl]-2-hydroxyethanone |
| SMILES | O=C(CO)N1CCC2(CCc3[nH]c4c(Cl)c(Cl)cc(-c5ccc(F)nc5F)c4c3C2)C1 |
| InChI | InChI=1S/C22H19Cl2F2N3O2/c23-14-7-12(11-1-2-16(25)28-21(11)26)18-13-8-22(5-6-29(10-22)17(31)9-30)4-3-15(13)27-20(18)19(14)24/h1-2,7,27,30H,3-6,8-10H2 |
| InChIKey | ONOXHVMGAQROHA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|