C21H20Cl2F2N4O2 — CID 177382969
1-[7,8-dichloro-5-[1-(difluoromethyl)pyrazol-4-yl]spiro[1,2,4,9-tetrahydrocarbazole-3,3'-pyrrolidine]-1'-yl]-2-hydroxyethanone (PubChem CID 177382969) has the molecular formula C21H20Cl2F2N4O2 and a molecular weight of 469.32 g/mol. Its IUPAC name is 1-[7,8-dichloro-5-[1-(difluoromethyl)pyrazol-4-yl]spiro[1,2,4,9-tetrahydrocarbazole-3,3'-pyrrolidine]-1'-yl]-2-hydroxyethanone.
| Compound Name | 1-[7,8-dichloro-5-[1-(difluoromethyl)pyrazol-4-yl]spiro[1,2,4,9-tetrahydrocarbazole-3,3'-pyrrolidine]-1'-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 177382969 |
| Molecular Formula | C21H20Cl2F2N4O2 |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 1-[7,8-dichloro-5-[1-(difluoromethyl)pyrazol-4-yl]spiro[1,2,4,9-tetrahydrocarbazole-3,3'-pyrrolidine]-1'-yl]-2-hydroxyethanone |
| SMILES | O=C(CO)N1CCC2(CCc3[nH]c4c(Cl)c(Cl)cc(-c5cnn(C(F)F)c5)c4c3C2)C1 |
| InChI | InChI=1S/C21H20Cl2F2N4O2/c22-14-5-12(11-7-26-29(8-11)20(24)25)17-13-6-21(3-4-28(10-21)16(31)9-30)2-1-15(13)27-19(17)18(14)23/h5,7-8,20,27,30H,1-4,6,9-10H2 |
| InChIKey | IXTKCSAOBPWHAH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |