C24H27Cl2N5O5 — CID 176557912
6-[2-[3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-9-yl]pyrazol-1-yl]ethylamino]-6-oxohexanoic acid (PubChem CID 176557912) has the molecular formula C24H27Cl2N5O5 and a molecular weight of 536.42 g/mol. Its IUPAC name is 6-[2-[3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-9-yl]pyrazol-1-yl]ethylamino]-6-oxohexanoic acid.
| Compound Name | 6-[2-[3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-9-yl]pyrazol-1-yl]ethylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 176557912 |
| Molecular Formula | C24H27Cl2N5O5 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 6-[2-[3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-9-yl]pyrazol-1-yl]ethylamino]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)NCCn1ccc(-c2cc(Cl)c(Cl)c3[nH]c4c(c23)CN(C(=O)CO)CC4)n1 |
| InChI | InChI=1S/C24H27Cl2N5O5/c25-16-11-14(18-6-9-31(29-18)10-7-27-19(33)3-1-2-4-21(35)36)22-15-12-30(20(34)13-32)8-5-17(15)28-24(22)23(16)26/h6,9,11,28,32H,1-5,7-8,10,12-13H2,(H,27,33)(H,35,36) |
| InChIKey | SWTXAFQZVDCCQW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|