C16H15Cl2N5O2 — CID 155104039
1-[10,11-dichloro-13-(1-methylpyrazol-3-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-4-yl]-2-hydroxyethanone (PubChem CID 155104039) has the molecular formula C16H15Cl2N5O2 and a molecular weight of 380.24 g/mol. Its IUPAC name is 1-[10,11-dichloro-13-(1-methylpyrazol-3-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-4-yl]-2-hydroxyethanone.
| Compound Name | 1-[10,11-dichloro-13-(1-methylpyrazol-3-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-4-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 155104039 |
| Molecular Formula | C16H15Cl2N5O2 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 1-[10,11-dichloro-13-(1-methylpyrazol-3-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-4-yl]-2-hydroxyethanone |
| SMILES | Cn1ccc(-c2nc(Cl)c(Cl)c3[nH]c4c(c23)CN(C(=O)CO)CC4)n1 |
| InChI | InChI=1S/C16H15Cl2N5O2/c1-22-4-2-10(21-22)14-12-8-6-23(11(25)7-24)5-3-9(8)19-15(12)13(17)16(18)20-14/h2,4,19,24H,3,5-7H2,1H3 |
| InChIKey | XJWIAOJVGBRMGG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|