C19H23Cl2N5O2 — CID 172580115
1-[9-[(Z)-1-amino-3-[2-(methylamino)ethylimino]prop-1-enyl]-6,7-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone (PubChem CID 172580115) has the molecular formula C19H23Cl2N5O2 and a molecular weight of 424.33 g/mol. Its IUPAC name is 1-[9-[(Z)-1-amino-3-[2-(methylamino)ethylimino]prop-1-enyl]-6,7-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone.
| Compound Name | 1-[9-[(Z)-1-amino-3-[2-(methylamino)ethylimino]prop-1-enyl]-6,7-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 172580115 |
| Molecular Formula | C19H23Cl2N5O2 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 1-[9-[(Z)-1-amino-3-[2-(methylamino)ethylimino]prop-1-enyl]-6,7-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone |
| SMILES | CNCC/N=C/C=C(\N)c1cc(Cl)c(Cl)c2[nH]c3c(c12)CN(C(=O)CO)CC3 |
| InChI | InChI=1S/C19H23Cl2N5O2/c1-23-5-6-24-4-2-14(22)11-8-13(20)18(21)19-17(11)12-9-26(16(28)10-27)7-3-15(12)25-19/h2,4,8,23,25,27H,3,5-7,9-10,22H2,1H3/b14-2-,24-4+ |
| InChIKey | PZFYMSLLLUZCED-FGDHNFBUSA-N |
| XLogP | 1.94 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|