C11H16N2S — CID 15511981
(1R,9aS)-9-methylsulfanyl-2,3,4,6,7,9a-hexahydro-1H-quinolizine-1-carbonitrile (PubChem CID 15511981) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is (1R,9aS)-9-methylsulfanyl-2,3,4,6,7,9a-hexahydro-1H-quinolizine-1-carbonitrile.
| Compound Name | (1R,9aS)-9-methylsulfanyl-2,3,4,6,7,9a-hexahydro-1H-quinolizine-1-carbonitrile |
|---|---|
| PubChem CID | 15511981 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | (1R,9aS)-9-methylsulfanyl-2,3,4,6,7,9a-hexahydro-1H-quinolizine-1-carbonitrile |
| SMILES | CSC1=CCCN2CCC[C@@H](C#N)[C@@H]12 |
| InChI | InChI=1S/C11H16N2S/c1-14-10-5-3-7-13-6-2-4-9(8-12)11(10)13/h5,9,11H,2-4,6-7H2,1H3/t9-,11-/m0/s1 |
| InChIKey | IFGOIFXGKWTPCE-ONGXEEELSA-N |
| XLogP | 2.24 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |