C12H21NS — CID 641986
(4aR,6R,8aS)-2,6-dimethyl-7-methylsulfanyl-3,4,4a,5,6,8a-hexahydro-1H-isoquinoline (PubChem CID 641986) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is (4aR,6R,8aS)-2,6-dimethyl-7-methylsulfanyl-3,4,4a,5,6,8a-hexahydro-1H-isoquinoline.
| Compound Name | (4aR,6R,8aS)-2,6-dimethyl-7-methylsulfanyl-3,4,4a,5,6,8a-hexahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 641986 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (4aR,6R,8aS)-2,6-dimethyl-7-methylsulfanyl-3,4,4a,5,6,8a-hexahydro-1H-isoquinoline |
| SMILES | CSC1=C[C@H]2CN(C)CC[C@H]2C[C@H]1C |
| InChI | InChI=1S/C12H21NS/c1-9-6-10-4-5-13(2)8-11(10)7-12(9)14-3/h7,9-11H,4-6,8H2,1-3H3/t9-,10+,11+/m1/s1 |
| InChIKey | SCZBPCZSVLPFDY-VWYCJHECSA-N |
| XLogP | 2.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |