C11H19NS — CID 641985
(3aS,5R,7aS)-2,5-dimethyl-6-methylsulfanyl-1,3,3a,4,5,7a-hexahydroisoindole (PubChem CID 641985) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is (3aS,5R,7aS)-2,5-dimethyl-6-methylsulfanyl-1,3,3a,4,5,7a-hexahydroisoindole.
| Compound Name | (3aS,5R,7aS)-2,5-dimethyl-6-methylsulfanyl-1,3,3a,4,5,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 641985 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (3aS,5R,7aS)-2,5-dimethyl-6-methylsulfanyl-1,3,3a,4,5,7a-hexahydroisoindole |
| SMILES | CSC1=C[C@H]2CN(C)C[C@H]2C[C@H]1C |
| InChI | InChI=1S/C11H19NS/c1-8-4-9-6-12(2)7-10(9)5-11(8)13-3/h5,8-10H,4,6-7H2,1-3H3/t8-,9-,10+/m1/s1 |
| InChIKey | SAIBCYPNTIMJCP-BBBLOLIVSA-N |
| XLogP | 2.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |