C12H22FNS — CID 176716326
2-(1,1,1,1,2,2,3,3a-octadeuterio-6-fluoro-4H-1-benzothiophen-3-yl)-N,N-dimethylethanamine (PubChem CID 176716326) has the molecular formula C12H22FNS and a molecular weight of 239.43 g/mol. Its IUPAC name is 2-(1,1,1,1,2,2,3,3a-octadeuterio-6-fluoro-4H-1-benzothiophen-3-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(1,1,1,1,2,2,3,3a-octadeuterio-6-fluoro-4H-1-benzothiophen-3-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 176716326 |
| Molecular Formula | C12H22FNS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 2-(1,1,1,1,2,2,3,3a-octadeuterio-6-fluoro-4H-1-benzothiophen-3-yl)-N,N-dimethylethanamine |
| SMILES | [2H]C12CC=C(F)C=C1S([2H])([2H])([2H])([2H])C([2H])([2H])C2([2H])CCN(C)C |
| InChI | InChI=1S/C12H22FNS/c1-14(2)6-5-9-8-15-12-7-10(13)3-4-11(9)12/h3,7,9,11H,4-6,8H2,1-2H3,15H4/i8D2,9D,11D,15D4 |
| InChIKey | ALJZGOMBPKOMAF-OKSCEFJKSA-N |
| XLogP | 1.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |