C12H23NS — CID 168971293
N-methyl-N-[(4-methylsulfanylcyclohex-3-en-1-yl)methyl]propan-1-amine (PubChem CID 168971293) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is N-methyl-N-[(4-methylsulfanylcyclohex-3-en-1-yl)methyl]propan-1-amine.
| Compound Name | N-methyl-N-[(4-methylsulfanylcyclohex-3-en-1-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 168971293 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | N-methyl-N-[(4-methylsulfanylcyclohex-3-en-1-yl)methyl]propan-1-amine |
| SMILES | CCCN(C)CC1CC=C(SC)CC1 |
| InChI | InChI=1S/C12H23NS/c1-4-9-13(2)10-11-5-7-12(14-3)8-6-11/h7,11H,4-6,8-10H2,1-3H3 |
| InChIKey | ZNOMNFAFXAQWOR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |