About (Z)-N,N,3-trimethyl-4-methylsulfanylhept-4-en-1-amine
(Z)-N,N,3-trimethyl-4-methylsulfanylhept-4-en-1-amine (PubChem CID 143782135) has the molecular formula C11H23NS
and a molecular weight of 201.38 g/mol. Its IUPAC name is (Z)-N,N,3-trimethyl-4-methylsulfanylhept-4-en-1-amine.
Analyze (Z)-N,N,3-trimethyl-4-methylsulfanylhept-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N,3-trimethyl-4-methylsulfanylhept-4-en-1-amine?
The IUPAC name of (Z)-N,N,3-trimethyl-4-methylsulfanylhept-4-en-1-amine (CID 143782135) is (Z)-N,N,3-trimethyl-4-methylsulfanylhept-4-en-1-amine.
What is the SMILES notation for (Z)-N,N,3-trimethyl-4-methylsulfanylhept-4-en-1-amine?
The canonical SMILES for (Z)-N,N,3-trimethyl-4-methylsulfanylhept-4-en-1-amine is CC/C=C(\SC)C(C)CCN(C)C.
What is the InChIKey of (Z)-N,N,3-trimethyl-4-methylsulfanylhept-4-en-1-amine?
The InChIKey is JHKDFKZEIJKFJY-XFFZJAGNSA-N. The full InChI is InChI=1S/C11H23NS/c1-6-7-11(13-5)10(2)8-9-12(3)4/h7,10H,6,8-9H2,1-5H3/b11-7-.
What are the key properties of (Z)-N,N,3-trimethyl-4-methylsulfanylhept-4-en-1-amine?
(Z)-N,N,3-trimethyl-4-methylsulfanylhept-4-en-1-amine has a molecular weight of 201.38 g/mol, XLogP of 3.23, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N,3-trimethyl-4-methylsulfanylhept-4-en-1-amine is sourced from PubChem (CID 143782135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).