About (Z)-N,N-dimethyl-4-methylsulfanylhex-4-en-1-amine
(Z)-N,N-dimethyl-4-methylsulfanylhex-4-en-1-amine (PubChem CID 143858940) has the molecular formula C9H19NS
and a molecular weight of 173.32 g/mol. Its IUPAC name is (Z)-N,N-dimethyl-4-methylsulfanylhex-4-en-1-amine.
Analyze (Z)-N,N-dimethyl-4-methylsulfanylhex-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N-dimethyl-4-methylsulfanylhex-4-en-1-amine?
The IUPAC name of (Z)-N,N-dimethyl-4-methylsulfanylhex-4-en-1-amine (CID 143858940) is (Z)-N,N-dimethyl-4-methylsulfanylhex-4-en-1-amine.
What is the SMILES notation for (Z)-N,N-dimethyl-4-methylsulfanylhex-4-en-1-amine?
The canonical SMILES for (Z)-N,N-dimethyl-4-methylsulfanylhex-4-en-1-amine is C/C=C(/CCCN(C)C)SC.
What is the InChIKey of (Z)-N,N-dimethyl-4-methylsulfanylhex-4-en-1-amine?
The InChIKey is XHDAWKVZBZWELU-UITAMQMPSA-N. The full InChI is InChI=1S/C9H19NS/c1-5-9(11-4)7-6-8-10(2)3/h5H,6-8H2,1-4H3/b9-5-.
What are the key properties of (Z)-N,N-dimethyl-4-methylsulfanylhex-4-en-1-amine?
(Z)-N,N-dimethyl-4-methylsulfanylhex-4-en-1-amine has a molecular weight of 173.32 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N-dimethyl-4-methylsulfanylhex-4-en-1-amine is sourced from PubChem (CID 143858940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).