C12H23NS — CID 142806868
(4E,6Z)-N,N-dimethyl-7-methylsulfanylhepta-4,6-dien-1-amine;ethene (PubChem CID 142806868) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is (4E,6Z)-N,N-dimethyl-7-methylsulfanylhepta-4,6-dien-1-amine;ethene.
| Compound Name | (4E,6Z)-N,N-dimethyl-7-methylsulfanylhepta-4,6-dien-1-amine;ethene |
|---|---|
| PubChem CID | 142806868 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | (4E,6Z)-N,N-dimethyl-7-methylsulfanylhepta-4,6-dien-1-amine;ethene |
| SMILES | C=C.CS/C=C\C=C\CCCN(C)C |
| InChI | InChI=1S/C10H19NS.C2H4/c1-11(2)9-7-5-4-6-8-10-12-3;1-2/h4,6,8,10H,5,7,9H2,1-3H3;1-2H2/b6-4+,10-8-; |
| InChIKey | NHCZLZMORVBHBS-JYYCZMCCSA-N |
| XLogP | 3.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|