C10H19NS — CID 142806869
(4E,6Z)-N,N-dimethyl-7-methylsulfanylhepta-4,6-dien-1-amine (PubChem CID 142806869) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is (4E,6Z)-N,N-dimethyl-7-methylsulfanylhepta-4,6-dien-1-amine.
| Compound Name | (4E,6Z)-N,N-dimethyl-7-methylsulfanylhepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 142806869 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (4E,6Z)-N,N-dimethyl-7-methylsulfanylhepta-4,6-dien-1-amine |
| SMILES | CS/C=C\C=C\CCCN(C)C |
| InChI | InChI=1S/C10H19NS/c1-11(2)9-7-5-4-6-8-10-12-3/h4,6,8,10H,5,7,9H2,1-3H3/b6-4+,10-8- |
| InChIKey | KKGTZIMTVFYVIG-VFAAGJRPSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|