About 1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene
1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene (PubChem CID 163393726) has the molecular formula C12H23NS
and a molecular weight of 213.39 g/mol. Its IUPAC name is 1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene.
Molecular Properties
| Compound Name | 1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene |
| PubChem CID | 163393726 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene |
| SMILES | C=C.C=CC(CC(S)N(C)C)=C(C)C |
| InChI | InChI=1S/C10H19NS.C2H4/c1-6-9(8(2)3)7-10(12)11(4)5;1-2/h6,10,12H,1,7H2,2-5H3;1-2H2 |
| InChIKey | KNCJQGRTAWFPSV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene?
The IUPAC name of 1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene (CID 163393726) is 1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene.
What is the SMILES notation for 1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene?
The canonical SMILES for 1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene is C=C.C=CC(CC(S)N(C)C)=C(C)C.
What is the InChIKey of 1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene?
The InChIKey is KNCJQGRTAWFPSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NS.C2H4/c1-6-9(8(2)3)7-10(12)11(4)5;1-2/h6,10,12H,1,7H2,2-5H3;1-2H2.
What are the key properties of 1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene?
1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene has a molecular weight of 213.39 g/mol, XLogP of 3.52, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)-3-ethenyl-4-methylpent-3-ene-1-thiol;ethene is sourced from PubChem (CID 163393726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).