C14H23NS — CID 143727507
5-[(Z)-but-1-enyl]-1-methyl-6-[(Z)-prop-1-enyl]-2,3,4,7-tetrahydroazepine-7-thiol (PubChem CID 143727507) has the molecular formula C14H23NS and a molecular weight of 237.41 g/mol. Its IUPAC name is 5-[(Z)-but-1-enyl]-1-methyl-6-[(Z)-prop-1-enyl]-2,3,4,7-tetrahydroazepine-7-thiol.
| Compound Name | 5-[(Z)-but-1-enyl]-1-methyl-6-[(Z)-prop-1-enyl]-2,3,4,7-tetrahydroazepine-7-thiol |
|---|---|
| PubChem CID | 143727507 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 5-[(Z)-but-1-enyl]-1-methyl-6-[(Z)-prop-1-enyl]-2,3,4,7-tetrahydroazepine-7-thiol |
| SMILES | C/C=C\C1=C(/C=C\CC)CCCN(C)C1S |
| InChI | InChI=1S/C14H23NS/c1-4-6-9-12-10-7-11-15(3)14(16)13(12)8-5-2/h5-6,8-9,14,16H,4,7,10-11H2,1-3H3/b8-5-,9-6- |
| InChIKey | AXFSATBRLDLJRW-VVRUXRSYSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|