About 5,6-bis(ethenyl)-1-methyl-2,3,4,7-tetrahydroazepine
5,6-bis(ethenyl)-1-methyl-2,3,4,7-tetrahydroazepine (PubChem CID 142113291) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-1-methyl-2,3,4,7-tetrahydroazepine.
Analyze 5,6-bis(ethenyl)-1-methyl-2,3,4,7-tetrahydroazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-bis(ethenyl)-1-methyl-2,3,4,7-tetrahydroazepine?
The IUPAC name of 5,6-bis(ethenyl)-1-methyl-2,3,4,7-tetrahydroazepine (CID 142113291) is 5,6-bis(ethenyl)-1-methyl-2,3,4,7-tetrahydroazepine.
What is the SMILES notation for 5,6-bis(ethenyl)-1-methyl-2,3,4,7-tetrahydroazepine?
The canonical SMILES for 5,6-bis(ethenyl)-1-methyl-2,3,4,7-tetrahydroazepine is C=CC1=C(C=C)CN(C)CCC1.
What is the InChIKey of 5,6-bis(ethenyl)-1-methyl-2,3,4,7-tetrahydroazepine?
The InChIKey is KUXPUYVOHDCIRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-4-10-7-6-8-12(3)9-11(10)5-2/h4-5H,1-2,6-9H2,3H3.
What are the key properties of 5,6-bis(ethenyl)-1-methyl-2,3,4,7-tetrahydroazepine?
5,6-bis(ethenyl)-1-methyl-2,3,4,7-tetrahydroazepine has a molecular weight of 163.26 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis(ethenyl)-1-methyl-2,3,4,7-tetrahydroazepine is sourced from PubChem (CID 142113291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).