About 1,5-dimethyl-6-prop-1-enyl-2,3,4,7-tetrahydroazepine
1,5-dimethyl-6-prop-1-enyl-2,3,4,7-tetrahydroazepine (PubChem CID 91336268) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 1,5-dimethyl-6-prop-1-enyl-2,3,4,7-tetrahydroazepine.
Analyze 1,5-dimethyl-6-prop-1-enyl-2,3,4,7-tetrahydroazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-6-prop-1-enyl-2,3,4,7-tetrahydroazepine?
The IUPAC name of 1,5-dimethyl-6-prop-1-enyl-2,3,4,7-tetrahydroazepine (CID 91336268) is 1,5-dimethyl-6-prop-1-enyl-2,3,4,7-tetrahydroazepine.
What is the SMILES notation for 1,5-dimethyl-6-prop-1-enyl-2,3,4,7-tetrahydroazepine?
The canonical SMILES for 1,5-dimethyl-6-prop-1-enyl-2,3,4,7-tetrahydroazepine is CC=CC1=C(C)CCCN(C)C1.
What is the InChIKey of 1,5-dimethyl-6-prop-1-enyl-2,3,4,7-tetrahydroazepine?
The InChIKey is WOUVDQIQMZHNBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-4-6-11-9-12(3)8-5-7-10(11)2/h4,6H,5,7-9H2,1-3H3.
What are the key properties of 1,5-dimethyl-6-prop-1-enyl-2,3,4,7-tetrahydroazepine?
1,5-dimethyl-6-prop-1-enyl-2,3,4,7-tetrahydroazepine has a molecular weight of 165.28 g/mol, XLogP of 2.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-6-prop-1-enyl-2,3,4,7-tetrahydroazepine is sourced from PubChem (CID 91336268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).