C29H49NS — CID 163385480
(4Z,7Z,10Z)-N-[2-[(1Z,4Z,7Z)-deca-1,4,7-trienyl]sulfanylethyl]-N-ethyl-2,3-dimethyltrideca-4,7,10-trien-1-amine (PubChem CID 163385480) has the molecular formula C29H49NS and a molecular weight of 443.79 g/mol. Its IUPAC name is (4Z,7Z,10Z)-N-[2-[(1Z,4Z,7Z)-deca-1,4,7-trienyl]sulfanylethyl]-N-ethyl-2,3-dimethyltrideca-4,7,10-trien-1-amine.
| Compound Name | (4Z,7Z,10Z)-N-[2-[(1Z,4Z,7Z)-deca-1,4,7-trienyl]sulfanylethyl]-N-ethyl-2,3-dimethyltrideca-4,7,10-trien-1-amine |
|---|---|
| PubChem CID | 163385480 |
| Molecular Formula | C29H49NS |
| Molecular Weight | 443.79 g/mol |
| Exact Mass | 443.36 |
| IUPAC Name | (4Z,7Z,10Z)-N-[2-[(1Z,4Z,7Z)-deca-1,4,7-trienyl]sulfanylethyl]-N-ethyl-2,3-dimethyltrideca-4,7,10-trien-1-amine |
| SMILES | CC/C=C\C/C=C\C/C=C\SCCN(CC)CC(C)C(C)/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C29H49NS/c1-6-9-11-13-15-17-19-21-23-28(4)29(5)27-30(8-3)24-26-31-25-22-20-18-16-14-12-10-7-2/h9-12,15-18,21-23,25,28-29H,6-8,13-14,19-20,24,26-27H2,1-5H3/b11-9-,12-10-,17-15-,18-16-,23-21-,25-22- |
| InChIKey | GHGGKVJEPAUNSQ-VNLNIMDBSA-N |
| XLogP | 8.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.79 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|