C13H25NS — CID 163762450
(2R,3Z)-N,N,2-trimethyl-3-[2-(propylsulfanylmethyl)cyclopropylidene]propan-1-amine (PubChem CID 163762450) has the molecular formula C13H25NS and a molecular weight of 227.42 g/mol. Its IUPAC name is (2R,3Z)-N,N,2-trimethyl-3-[2-(propylsulfanylmethyl)cyclopropylidene]propan-1-amine.
| Compound Name | (2R,3Z)-N,N,2-trimethyl-3-[2-(propylsulfanylmethyl)cyclopropylidene]propan-1-amine |
|---|---|
| PubChem CID | 163762450 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (2R,3Z)-N,N,2-trimethyl-3-[2-(propylsulfanylmethyl)cyclopropylidene]propan-1-amine |
| SMILES | CCCSCC1C/C1=C/[C@@H](C)CN(C)C |
| InChI | InChI=1S/C13H25NS/c1-5-6-15-10-13-8-12(13)7-11(2)9-14(3)4/h7,11,13H,5-6,8-10H2,1-4H3/b12-7-/t11-,13?/m1/s1 |
| InChIKey | LZIODLGZJMFQNU-DVJJTCDSSA-N |
| XLogP | 3.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|