C9H17NS — CID 164787816
N,N-dimethyl-1-[(3R)-4-methyl-3,6-dihydro-2H-thiopyran-3-yl]methanamine (PubChem CID 164787816) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is N,N-dimethyl-1-[(3R)-4-methyl-3,6-dihydro-2H-thiopyran-3-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[(3R)-4-methyl-3,6-dihydro-2H-thiopyran-3-yl]methanamine |
|---|---|
| PubChem CID | 164787816 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | N,N-dimethyl-1-[(3R)-4-methyl-3,6-dihydro-2H-thiopyran-3-yl]methanamine |
| SMILES | CC1=CCSC[C@H]1CN(C)C |
| InChI | InChI=1S/C9H17NS/c1-8-4-5-11-7-9(8)6-10(2)3/h4,9H,5-7H2,1-3H3/t9-/m1/s1 |
| InChIKey | VUWJYMJEMMFWDQ-SECBINFHSA-N |
| XLogP | 1.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|