C24H28N2O6 — CID 15512172
methyl (2S,3R)-3-hydroxy-2-[[(2S,3S)-3-phenyl-2-(phenylmethoxycarbonylamino)pent-4-enoyl]amino]butanoate (PubChem CID 15512172) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is methyl (2S,3R)-3-hydroxy-2-[[(2S,3S)-3-phenyl-2-(phenylmethoxycarbonylamino)pent-4-enoyl]amino]butanoate.
| Compound Name | methyl (2S,3R)-3-hydroxy-2-[[(2S,3S)-3-phenyl-2-(phenylmethoxycarbonylamino)pent-4-enoyl]amino]butanoate |
|---|---|
| PubChem CID | 15512172 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | methyl (2S,3R)-3-hydroxy-2-[[(2S,3S)-3-phenyl-2-(phenylmethoxycarbonylamino)pent-4-enoyl]amino]butanoate |
| SMILES | C=C[C@@H](c1ccccc1)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@H](C(=O)OC)[C@@H](C)O |
| InChI | InChI=1S/C24H28N2O6/c1-4-19(18-13-9-6-10-14-18)21(22(28)25-20(16(2)27)23(29)31-3)26-24(30)32-15-17-11-7-5-8-12-17/h4-14,16,19-21,27H,1,15H2,2-3H3,(H,25,28)(H,26,30)/t16-,19+,20+,21+/m1/s1 |
| InChIKey | HJOMVONAJHWWBO-SEVLPDGMSA-N |
| XLogP | 2.29 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|