C27H40ClN5O6 — CID 155122069
tert-butyl 4-[[(2S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-(2-hydroxypropan-2-yloxy)oxolan-2-yl]methyl]-1-oxa-4,8-diazaspiro[5.5]undecane-8-carboxylate (PubChem CID 155122069) has the molecular formula C27H40ClN5O6 and a molecular weight of 566.10 g/mol. Its IUPAC name is tert-butyl 4-[[(2S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-(2-hydroxypropan-2-yloxy)oxolan-2-yl]methyl]-1-oxa-4,8-diazaspiro[5.5]undecane-8-carboxylate.
| Compound Name | tert-butyl 4-[[(2S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-(2-hydroxypropan-2-yloxy)oxolan-2-yl]methyl]-1-oxa-4,8-diazaspiro[5.5]undecane-8-carboxylate |
|---|---|
| PubChem CID | 155122069 |
| Molecular Formula | C27H40ClN5O6 |
| Molecular Weight | 566.10 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | tert-butyl 4-[[(2S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-(2-hydroxypropan-2-yloxy)oxolan-2-yl]methyl]-1-oxa-4,8-diazaspiro[5.5]undecane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(CN(C[C@@H]3C[C@@H](OC(C)(C)O)[C@H](n4ccc5c(Cl)ncnc54)O3)CCO2)C1 |
| InChI | InChI=1S/C27H40ClN5O6/c1-25(2,3)39-24(34)32-9-6-8-27(16-32)15-31(11-12-36-27)14-18-13-20(38-26(4,5)35)23(37-18)33-10-7-19-21(28)29-17-30-22(19)33/h7,10,17-18,20,23,35H,6,8-9,11-16H2,1-5H3/t18-,20+,23+,27?/m0/s1 |
| InChIKey | LKSZSZHUJFRJPU-JVYLLHQESA-N |
| XLogP | 3.59 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.10 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|