About 2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol
2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol (PubChem CID 155123855) has the molecular formula C14H34N2O3
and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol.
Molecular Properties
| Compound Name | 2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol |
| PubChem CID | 155123855 |
| Molecular Formula | C14H34N2O3 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | 2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol |
| SMILES | CCCCC(CO)NCCO.CCN(CC)CCO |
| InChI | InChI=1S/C8H19NO2.C6H15NO/c1-2-3-4-8(7-11)9-5-6-10;1-3-7(4-2)5-6-8/h8-11H,2-7H2,1H3;8H,3-6H2,1-2H3 |
| InChIKey | RNJLQEHXOQRJAS-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol?
The IUPAC name of 2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol (CID 155123855) is 2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol.
What is the SMILES notation for 2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol?
The canonical SMILES for 2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol is CCCCC(CO)NCCO.CCN(CC)CCO.
What is the InChIKey of 2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol?
The InChIKey is RNJLQEHXOQRJAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO2.C6H15NO/c1-2-3-4-8(7-11)9-5-6-10;1-3-7(4-2)5-6-8/h8-11H,2-7H2,1H3;8H,3-6H2,1-2H3.
What are the key properties of 2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol?
2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol has a molecular weight of 278.44 g/mol, XLogP of 0.44, 11 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethanol;2-(2-hydroxyethylamino)hexan-1-ol is sourced from PubChem (CID 155123855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).