C10H12BrNO2S — CID 155124766
ethyl 5-bromo-2-cyclobutyl-1,3-thiazole-4-carboxylate (PubChem CID 155124766) has the molecular formula C10H12BrNO2S and a molecular weight of 290.18 g/mol. Its IUPAC name is ethyl 5-bromo-2-cyclobutyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-bromo-2-cyclobutyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 155124766 |
| Molecular Formula | C10H12BrNO2S |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | ethyl 5-bromo-2-cyclobutyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(C2CCC2)sc1Br |
| InChI | InChI=1S/C10H12BrNO2S/c1-2-14-10(13)7-8(11)15-9(12-7)6-4-3-5-6/h6H,2-5H2,1H3 |
| InChIKey | XLGCLYCHZWFOCX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |