C21H26N2O3S — CID 23627645
ethyl 2-cyclopentyl-5-(2-phenylbutanoylamino)-1,3-thiazole-4-carboxylate (PubChem CID 23627645) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is ethyl 2-cyclopentyl-5-(2-phenylbutanoylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-cyclopentyl-5-(2-phenylbutanoylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 23627645 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | ethyl 2-cyclopentyl-5-(2-phenylbutanoylamino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(C2CCCC2)sc1NC(=O)C(CC)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-3-16(14-10-6-5-7-11-14)18(24)23-20-17(21(25)26-4-2)22-19(27-20)15-12-8-9-13-15/h5-7,10-11,15-16H,3-4,8-9,12-13H2,1-2H3,(H,23,24) |
| InChIKey | NAKWVUOUDNSLOO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |