C25H21ClF3NO4 — CID 155127990
benzyl 3-[3-chloro-4-(trifluoromethyl)phenyl]-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 155127990) has the molecular formula C25H21ClF3NO4 and a molecular weight of 491.89 g/mol. Its IUPAC name is benzyl 3-[3-chloro-4-(trifluoromethyl)phenyl]-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | benzyl 3-[3-chloro-4-(trifluoromethyl)phenyl]-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 155127990 |
| Molecular Formula | C25H21ClF3NO4 |
| Molecular Weight | 491.89 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | benzyl 3-[3-chloro-4-(trifluoromethyl)phenyl]-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | O=C(NC(Cc1ccc(C(F)(F)F)c(Cl)c1)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C25H21ClF3NO4/c26-21-13-19(11-12-20(21)25(27,28)29)14-22(23(31)33-15-17-7-3-1-4-8-17)30-24(32)34-16-18-9-5-2-6-10-18/h1-13,22H,14-16H2,(H,30,32) |
| InChIKey | BFQBGUTYTVVYEC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.89 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |