C22H22N4O — CID 155128760
4-(3-methylimidazol-4-yl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzamide (PubChem CID 155128760) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 4-(3-methylimidazol-4-yl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzamide.
| Compound Name | 4-(3-methylimidazol-4-yl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 155128760 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 4-(3-methylimidazol-4-yl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzamide |
| SMILES | Cc1[nH]c2ccccc2c1CCNC(=O)c1ccc(-c2cncn2C)cc1 |
| InChI | InChI=1S/C22H22N4O/c1-15-18(19-5-3-4-6-20(19)25-15)11-12-24-22(27)17-9-7-16(8-10-17)21-13-23-14-26(21)2/h3-10,13-14,25H,11-12H2,1-2H3,(H,24,27) |
| InChIKey | UFPBVJYJYXTLOO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|