C4H15N7 — CID 155130453
1,2,3-triamino-1-(3-aminopropyl)guanidine (PubChem CID 155130453) has the molecular formula C4H15N7 and a molecular weight of 161.21 g/mol. Its IUPAC name is 1,2,3-triamino-1-(3-aminopropyl)guanidine.
| Compound Name | 1,2,3-triamino-1-(3-aminopropyl)guanidine |
|---|---|
| PubChem CID | 155130453 |
| Molecular Formula | C4H15N7 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 1,2,3-triamino-1-(3-aminopropyl)guanidine |
| SMILES | NCCCN(N)/C(=N/N)NN |
| InChI | InChI=1S/C4H15N7/c5-2-1-3-11(8)4(9-6)10-7/h1-3,5-8H2,(H,9,10) |
| InChIKey | DWCUHWOLHMJJDS-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 131.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|