C7H18N4O2S2 — CID 87290323
aminocarbamothioic S-acid;amino(pentyl)carbamothioic S-acid (PubChem CID 87290323) has the molecular formula C7H18N4O2S2 and a molecular weight of 254.38 g/mol. Its IUPAC name is aminocarbamothioic S-acid;amino(pentyl)carbamothioic S-acid.
| Compound Name | aminocarbamothioic S-acid;amino(pentyl)carbamothioic S-acid |
|---|---|
| PubChem CID | 87290323 |
| Molecular Formula | C7H18N4O2S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | aminocarbamothioic S-acid;amino(pentyl)carbamothioic S-acid |
| SMILES | CCCCCN(N)C(=O)S.NNC(=O)S |
| InChI | InChI=1S/C6H14N2OS.CH4N2OS/c1-2-3-4-5-8(7)6(9)10;2-3-1(4)5/h2-5,7H2,1H3,(H,9,10);2H2,(H2,3,4,5) |
| InChIKey | DPEJAVGDVMPZFH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|