C14H10OS — CID 155130932
6,7-dihydro-[1]benzothiolo[3,2-b][1]benzofuran (PubChem CID 155130932) has the molecular formula C14H10OS and a molecular weight of 226.30 g/mol. Its IUPAC name is 6,7-dihydro-[1]benzothiolo[3,2-b][1]benzofuran.
| Compound Name | 6,7-dihydro-[1]benzothiolo[3,2-b][1]benzofuran |
|---|---|
| PubChem CID | 155130932 |
| Molecular Formula | C14H10OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 6,7-dihydro-[1]benzothiolo[3,2-b][1]benzofuran |
| SMILES | C1=Cc2c(oc3c2sc2ccccc23)CC1 |
| InChI | InChI=1S/C14H10OS/c1-3-7-11-9(5-1)14-13(15-11)10-6-2-4-8-12(10)16-14/h1-2,4-6,8H,3,7H2 |
| InChIKey | IXHQLSDIWUBKTA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |