C13H18N2O4 — CID 155133310
4-[(2R)-1-phenylmethoxypropan-2-yl]-1,2,4,6-dioxadiazepan-5-one (PubChem CID 155133310) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-[(2R)-1-phenylmethoxypropan-2-yl]-1,2,4,6-dioxadiazepan-5-one.
| Compound Name | 4-[(2R)-1-phenylmethoxypropan-2-yl]-1,2,4,6-dioxadiazepan-5-one |
|---|---|
| PubChem CID | 155133310 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 4-[(2R)-1-phenylmethoxypropan-2-yl]-1,2,4,6-dioxadiazepan-5-one |
| SMILES | C[C@H](COCc1ccccc1)N1COOCNC1=O |
| InChI | InChI=1S/C13H18N2O4/c1-11(15-10-19-18-9-14-13(15)16)7-17-8-12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3,(H,14,16)/t11-/m1/s1 |
| InChIKey | BBXVDBLQEXGSMG-LLVKDONJSA-N |
| XLogP | 1.48 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|