C30H32ClN3O2 — CID 155133643
methyl 2-[3-[4-(1-adamantyl)-2-chloroanilino]-N-methylanilino]pyridine-3-carboxylate (PubChem CID 155133643) has the molecular formula C30H32ClN3O2 and a molecular weight of 502.00 g/mol. Its IUPAC name is methyl 2-[3-[4-(1-adamantyl)-2-chloroanilino]-N-methylanilino]pyridine-3-carboxylate.
| Compound Name | methyl 2-[3-[4-(1-adamantyl)-2-chloroanilino]-N-methylanilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 155133643 |
| Molecular Formula | C30H32ClN3O2 |
| Molecular Weight | 502.00 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | methyl 2-[3-[4-(1-adamantyl)-2-chloroanilino]-N-methylanilino]pyridine-3-carboxylate |
| SMILES | CN(C1=CC=CC(=C1)NC2=C(C=C(C=C2)C34CC5CC(C3)CC(C5)C4)Cl)C6=C(C=CC=N6)C(=O)OC |
| InChI | InChI=1S/C30H32ClN3O2/c1-34(28-25(29(35)36-2)7-4-10-32-28)24-6-3-5-23(15-24)33-27-9-8-22(14-26(27)31)30-16-19-11-20(17-30)13-21(12-19)18-30/h3-10,14-15,19-21,33H,11-13,16-18H2,1-2H3 |
| InChIKey | QEXYHKFRARTONY-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 54.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | 751 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.00 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |