C30H30F3N3O2 — CID 155133681
methyl 2-[3-[4-(1-adamantyl)anilino]-5-(trifluoromethyl)anilino]pyridine-3-carboxylate (PubChem CID 155133681) has the molecular formula C30H30F3N3O2 and a molecular weight of 521.58 g/mol. Its IUPAC name is methyl 2-[3-[4-(1-adamantyl)anilino]-5-(trifluoromethyl)anilino]pyridine-3-carboxylate.
| Compound Name | methyl 2-[3-[4-(1-adamantyl)anilino]-5-(trifluoromethyl)anilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 155133681 |
| Molecular Formula | C30H30F3N3O2 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | methyl 2-[3-[4-(1-adamantyl)anilino]-5-(trifluoromethyl)anilino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1Nc1cc(Nc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H30F3N3O2/c1-38-28(37)26-3-2-8-34-27(26)36-25-13-22(30(31,32)33)12-24(14-25)35-23-6-4-21(5-7-23)29-15-18-9-19(16-29)11-20(10-18)17-29/h2-8,12-14,18-20,35H,9-11,15-17H2,1H3,(H,34,36) |
| InChIKey | RVXNVOVSACDUHQ-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |