C25H26ClN3O2 — CID 155134133
6-[4-(2-chloro-4-cyclohexylanilino)-2-methylanilino]pyridine-2-carboxylic acid (PubChem CID 155134133) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is 6-[4-(2-chloro-4-cyclohexylanilino)-2-methylanilino]pyridine-2-carboxylic acid.
| Compound Name | 6-[4-(2-chloro-4-cyclohexylanilino)-2-methylanilino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 155134133 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 6-[4-(2-chloro-4-cyclohexylanilino)-2-methylanilino]pyridine-2-carboxylic acid |
| SMILES | Cc1cc(Nc2ccc(C3CCCCC3)cc2Cl)ccc1Nc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C25H26ClN3O2/c1-16-14-19(11-13-21(16)28-24-9-5-8-23(29-24)25(30)31)27-22-12-10-18(15-20(22)26)17-6-3-2-4-7-17/h5,8-15,17,27H,2-4,6-7H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | MIRFFUBVBRSTBV-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |