C23H21F3N2O4 — CID 155134478
5-methoxy-2-[2-methyl-4-[N-methyl-4-(trifluoromethoxy)anilino]anilino]benzoic acid (PubChem CID 155134478) has the molecular formula C23H21F3N2O4 and a molecular weight of 446.43 g/mol. Its IUPAC name is 5-methoxy-2-[2-methyl-4-[N-methyl-4-(trifluoromethoxy)anilino]anilino]benzoic acid.
| Compound Name | 5-methoxy-2-[2-methyl-4-[N-methyl-4-(trifluoromethoxy)anilino]anilino]benzoic acid |
|---|---|
| PubChem CID | 155134478 |
| Molecular Formula | C23H21F3N2O4 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 5-methoxy-2-[2-methyl-4-[N-methyl-4-(trifluoromethoxy)anilino]anilino]benzoic acid |
| SMILES | COc1ccc(Nc2ccc(N(C)c3ccc(OC(F)(F)F)cc3)cc2C)c(C(=O)O)c1 |
| InChI | InChI=1S/C23H21F3N2O4/c1-14-12-16(28(2)15-4-7-17(8-5-15)32-23(24,25)26)6-10-20(14)27-21-11-9-18(31-3)13-19(21)22(29)30/h4-13,27H,1-3H3,(H,29,30) |
| InChIKey | DHGJDQYDOIKCLV-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_G(1)', 'substructure': 'N/A'} |
|---|