C27H28F2N2O3 — CID 155133542
2-[4-[4-(4,4-difluorocyclohexyl)-N-methylanilino]anilino]-5-methoxybenzoic acid (PubChem CID 155133542) has the molecular formula C27H28F2N2O3 and a molecular weight of 466.53 g/mol. Its IUPAC name is 2-[4-[4-(4,4-difluorocyclohexyl)-N-methylanilino]anilino]-5-methoxybenzoic acid.
| Compound Name | 2-[4-[4-(4,4-difluorocyclohexyl)-N-methylanilino]anilino]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 155133542 |
| Molecular Formula | C27H28F2N2O3 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2-[4-[4-(4,4-difluorocyclohexyl)-N-methylanilino]anilino]-5-methoxybenzoic acid |
| SMILES | COc1ccc(Nc2ccc(N(C)c3ccc(C4CCC(F)(F)CC4)cc3)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C27H28F2N2O3/c1-31(21-7-3-18(4-8-21)19-13-15-27(28,29)16-14-19)22-9-5-20(6-10-22)30-25-12-11-23(34-2)17-24(25)26(32)33/h3-12,17,19,30H,13-16H2,1-2H3,(H,32,33) |
| InChIKey | CMUMNHBJTWGTJG-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_acid_G(1)', 'substructure': 'N/A'} |
|---|