C29H32N2O3 — CID 155133671
methyl 2-[4-[4-(2-bicyclo[2.2.1]heptanyl)-N-methylanilino]anilino]-5-methoxybenzoate (PubChem CID 155133671) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is methyl 2-[4-[4-(2-bicyclo[2.2.1]heptanyl)-N-methylanilino]anilino]-5-methoxybenzoate.
| Compound Name | methyl 2-[4-[4-(2-bicyclo[2.2.1]heptanyl)-N-methylanilino]anilino]-5-methoxybenzoate |
|---|---|
| PubChem CID | 155133671 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | methyl 2-[4-[4-(2-bicyclo[2.2.1]heptanyl)-N-methylanilino]anilino]-5-methoxybenzoate |
| SMILES | COC(=O)c1cc(OC)ccc1Nc1ccc(N(C)c2ccc(C3CC4CCC3C4)cc2)cc1 |
| InChI | InChI=1S/C29H32N2O3/c1-31(23-10-6-20(7-11-23)26-17-19-4-5-21(26)16-19)24-12-8-22(9-13-24)30-28-15-14-25(33-2)18-27(28)29(32)34-3/h6-15,18-19,21,26,30H,4-5,16-17H2,1-3H3 |
| InChIKey | MVNJGKWXDLWAME-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |