C21H45NO3 — CID 155135764
3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine (PubChem CID 155135764) has the molecular formula C21H45NO3 and a molecular weight of 359.60 g/mol. Its IUPAC name is 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine.
| Compound Name | 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 155135764 |
| Molecular Formula | C21H45NO3 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.34 |
| IUPAC Name | 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine |
| SMILES | CCOC(C)(C)CCN(CCC(C)(C)OCC)CCC(C)(C)OCC |
| InChI | InChI=1S/C21H45NO3/c1-10-23-19(4,5)13-16-22(17-14-20(6,7)24-11-2)18-15-21(8,9)25-12-3/h10-18H2,1-9H3 |
| InChIKey | XAWYAKRSAGPFKH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |