About 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine
3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine (PubChem CID 155135764) has the molecular formula C21H45NO3
and a molecular weight of 359.60 g/mol. Its IUPAC name is 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine.
Molecular Properties
| Compound Name | 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine |
| PubChem CID | 155135764 |
| Molecular Formula | C21H45NO3 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.34 |
| IUPAC Name | 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine |
| SMILES | CCOC(C)(C)CCN(CCC(C)(C)OCC)CCC(C)(C)OCC |
| InChI | InChI=1S/C21H45NO3/c1-10-23-19(4,5)13-16-22(17-14-20(6,7)24-11-2)18-15-21(8,9)25-12-3/h10-18H2,1-9H3 |
| InChIKey | XAWYAKRSAGPFKH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine?
The IUPAC name of 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine (CID 155135764) is 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine.
What is the SMILES notation for 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine?
The canonical SMILES for 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine is CCOC(C)(C)CCN(CCC(C)(C)OCC)CCC(C)(C)OCC.
What is the InChIKey of 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine?
The InChIKey is XAWYAKRSAGPFKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H45NO3/c1-10-23-19(4,5)13-16-22(17-14-20(6,7)24-11-2)18-15-21(8,9)25-12-3/h10-18H2,1-9H3.
What are the key properties of 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine?
3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine has a molecular weight of 359.60 g/mol, XLogP of 4.90, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-N,N-bis(3-ethoxy-3-methylbutyl)-3-methylbutan-1-amine is sourced from PubChem (CID 155135764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).