C9H20N2O2S — CID 155135901
[2,3-dimethylbutyl(sulfamoyl)amino]cyclopropane (PubChem CID 155135901) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is [2,3-dimethylbutyl(sulfamoyl)amino]cyclopropane.
| Compound Name | [2,3-dimethylbutyl(sulfamoyl)amino]cyclopropane |
|---|---|
| PubChem CID | 155135901 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | [2,3-dimethylbutyl(sulfamoyl)amino]cyclopropane |
| SMILES | CC(C)C(C)CN(C1CC1)S(N)(=O)=O |
| InChI | InChI=1S/C9H20N2O2S/c1-7(2)8(3)6-11(9-4-5-9)14(10,12)13/h7-9H,4-6H2,1-3H3,(H2,10,12,13) |
| InChIKey | GOLWKLCDPFTZRJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |