C50H32F2N4O2S — CID 155136081
4-[4-[N-[7-[4-(3,6-difluorocarbazol-9-yl)phenyl]-2,1,3-benzothiadiazol-4-yl]-4-(4-methoxyphenyl)anilino]phenyl]benzaldehyde (PubChem CID 155136081) has the molecular formula C50H32F2N4O2S and a molecular weight of 790.90 g/mol. Its IUPAC name is 4-[4-[N-[7-[4-(3,6-difluorocarbazol-9-yl)phenyl]-2,1,3-benzothiadiazol-4-yl]-4-(4-methoxyphenyl)anilino]phenyl]benzaldehyde.
| Compound Name | 4-[4-[N-[7-[4-(3,6-difluorocarbazol-9-yl)phenyl]-2,1,3-benzothiadiazol-4-yl]-4-(4-methoxyphenyl)anilino]phenyl]benzaldehyde |
|---|---|
| PubChem CID | 155136081 |
| Molecular Formula | C50H32F2N4O2S |
| Molecular Weight | 790.90 g/mol |
| Exact Mass | 790.22 |
| IUPAC Name | 4-[4-[N-[7-[4-(3,6-difluorocarbazol-9-yl)phenyl]-2,1,3-benzothiadiazol-4-yl]-4-(4-methoxyphenyl)anilino]phenyl]benzaldehyde |
| SMILES | COc1ccc(-c2ccc(N(c3ccc(-c4ccc(C=O)cc4)cc3)c3ccc(-c4ccc(-n5c6ccc(F)cc6c6cc(F)ccc65)cc4)c4nsnc34)cc2)cc1 |
| InChI | InChI=1S/C50H32F2N4O2S/c1-58-42-22-12-35(13-23-42)34-8-18-40(19-9-34)55(39-16-6-33(7-17-39)32-4-2-31(30-57)3-5-32)48-27-24-43(49-50(48)54-59-53-49)36-10-20-41(21-11-36)56-46-25-14-37(51)28-44(46)45-29-38(52)15-26-47(45)56/h2-30H,1H3 |
| InChIKey | YSGLIBXUXASQNY-UHFFFAOYSA-N |
| XLogP | 13.36 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.90 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|