C10H12IN3 — CID 155136336
6-(2-iodopropan-2-yl)-2-methyl-1H-imidazo[4,5-b]pyridine (PubChem CID 155136336) has the molecular formula C10H12IN3 and a molecular weight of 301.13 g/mol. Its IUPAC name is 6-(2-iodopropan-2-yl)-2-methyl-1H-imidazo[4,5-b]pyridine.
| Compound Name | 6-(2-iodopropan-2-yl)-2-methyl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 155136336 |
| Molecular Formula | C10H12IN3 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 6-(2-iodopropan-2-yl)-2-methyl-1H-imidazo[4,5-b]pyridine |
| SMILES | Cc1nc2ncc(C(C)(C)I)cc2[nH]1 |
| InChI | InChI=1S/C10H12IN3/c1-6-13-8-4-7(10(2,3)11)5-12-9(8)14-6/h4-5H,1-3H3,(H,12,13,14) |
| InChIKey | LPIBEJYESUAXJO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|