C5H9FN2 — CID 155136872
(Z,3E)-3-(fluoromethylimino)-2-methylprop-1-en-1-amine (PubChem CID 155136872) has the molecular formula C5H9FN2 and a molecular weight of 116.14 g/mol. Its IUPAC name is (Z,3E)-3-(fluoromethylimino)-2-methylprop-1-en-1-amine.
| Compound Name | (Z,3E)-3-(fluoromethylimino)-2-methylprop-1-en-1-amine |
|---|---|
| PubChem CID | 155136872 |
| Molecular Formula | C5H9FN2 |
| Molecular Weight | 116.14 g/mol |
| Exact Mass | 116.07 |
| IUPAC Name | (Z,3E)-3-(fluoromethylimino)-2-methylprop-1-en-1-amine |
| SMILES | CC(=C/N)/C=N/CF |
| InChI | InChI=1S/C5H9FN2/c1-5(2-7)3-8-4-6/h2-3H,4,7H2,1H3/b5-2-,8-3+ |
| InChIKey | AUMYDHVLKXRVCI-IEQZRIFLSA-N |
| XLogP | 0.85 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.14 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|