C14H24N4O2S2 — CID 155137506
(4S,7S)-8,8-dimethyl-4-[[2-(methylamino)ethanethioyl]amino]-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepine-7-carboxamide (PubChem CID 155137506) has the molecular formula C14H24N4O2S2 and a molecular weight of 344.51 g/mol. Its IUPAC name is (4S,7S)-8,8-dimethyl-4-[[2-(methylamino)ethanethioyl]amino]-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepine-7-carboxamide.
| Compound Name | (4S,7S)-8,8-dimethyl-4-[[2-(methylamino)ethanethioyl]amino]-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepine-7-carboxamide |
|---|---|
| PubChem CID | 155137506 |
| Molecular Formula | C14H24N4O2S2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (4S,7S)-8,8-dimethyl-4-[[2-(methylamino)ethanethioyl]amino]-5-oxo-2,3,4,7,9,9a-hexahydropyrrolo[2,1-b][1,3]thiazepine-7-carboxamide |
| SMILES | CNCC(=S)N[C@H]1CCSC2CC(C)(C)[C@@H](C(N)=O)N2C1=O |
| InChI | InChI=1S/C14H24N4O2S2/c1-14(2)6-10-18(11(14)12(15)19)13(20)8(4-5-22-10)17-9(21)7-16-3/h8,10-11,16H,4-7H2,1-3H3,(H2,15,19)(H,17,21)/t8-,10?,11+/m0/s1 |
| InChIKey | XAEGVRTZFPMRIO-UMYMBVSISA-N |
| XLogP | 0.07 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|